C30H34N2O5 — CID 46229160
methyl (1R,9S,11S,14E,15S,17S,19R)-14-ethylidene-6-methoxy-2-methyl-19-(phenylmethoxymethyl)-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3(8),4,6-triene-19-carboxylate (PubChem CID 46229160) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is methyl (1R,9S,11S,14E,15S,17S,19R)-14-ethylidene-6-methoxy-2-methyl-19-(phenylmethoxymethyl)-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3(8),4,6-triene-19-carboxylate.
| Compound Name | methyl (1R,9S,11S,14E,15S,17S,19R)-14-ethylidene-6-methoxy-2-methyl-19-(phenylmethoxymethyl)-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3(8),4,6-triene-19-carboxylate |
|---|---|
| PubChem CID | 46229160 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | methyl (1R,9S,11S,14E,15S,17S,19R)-14-ethylidene-6-methoxy-2-methyl-19-(phenylmethoxymethyl)-18-oxa-2,12-diazahexacyclo[9.6.1.19,15.01,9.03,8.012,17]nonadeca-3(8),4,6-triene-19-carboxylate |
| SMILES | C/C=C1/CN2[C@@H]3C[C@@]45c6cc(OC)ccc6N(C)[C@]4(O3)[C@@H]2C[C@@H]1[C@@]5(COCc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C30H34N2O5/c1-5-20-16-32-25-14-22(20)28(27(33)35-4,18-36-17-19-9-7-6-8-10-19)29-15-26(32)37-30(25,29)31(2)24-12-11-21(34-3)13-23(24)29/h5-13,22,25-26H,14-18H2,1-4H3/b20-5-/t22-,25-,26-,28-,29-,30-/m0/s1 |
| InChIKey | MNIQABZMEGEMDV-JMIQPODXSA-N |
| XLogP | 3.87 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|