C17H27NO — CID 46230682
(2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenamide (PubChem CID 46230682) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is (2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenamide.
| Compound Name | (2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenamide |
|---|---|
| PubChem CID | 46230682 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | (2E,4E,8E)-5,9,13-trimethyltetradeca-2,4,8,12-tetraenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C=C/C(N)=O |
| InChI | InChI=1S/C17H27NO/c1-14(2)8-5-9-15(3)10-6-11-16(4)12-7-13-17(18)19/h7-8,10,12-13H,5-6,9,11H2,1-4H3,(H2,18,19)/b13-7+,15-10+,16-12+ |
| InChIKey | HEWHJSZFNDQPQW-YKXWRRLFSA-N |
| XLogP | 4.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|