C15H22N6O3S — CID 46234561
1-[(3R)-1-propylsulfonylpiperidin-3-yl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 46234561) has the molecular formula C15H22N6O3S and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-[(3R)-1-propylsulfonylpiperidin-3-yl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
| Compound Name | 1-[(3R)-1-propylsulfonylpiperidin-3-yl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
|---|---|
| PubChem CID | 46234561 |
| Molecular Formula | C15H22N6O3S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[(3R)-1-propylsulfonylpiperidin-3-yl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | CCCS(=O)(=O)N1CCC[C@@H](NC(=O)Nc2cnc3[nH]ccc3n2)C1 |
| InChI | InChI=1S/C15H22N6O3S/c1-2-8-25(23,24)21-7-3-4-11(10-21)18-15(22)20-13-9-17-14-12(19-13)5-6-16-14/h5-6,9,11H,2-4,7-8,10H2,1H3,(H,16,17)(H2,18,19,20,22)/t11-/m1/s1 |
| InChIKey | SBOHKFPSDBFHCW-LLVKDONJSA-N |
| XLogP | 1.28 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |