C15H21N5O — CID 46234076
1-[(1S,2R)-2-methylcycloheptyl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 46234076) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcycloheptyl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
| Compound Name | 1-[(1S,2R)-2-methylcycloheptyl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
|---|---|
| PubChem CID | 46234076 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 1-[(1S,2R)-2-methylcycloheptyl]-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | C[C@@H]1CCCCC[C@@H]1NC(=O)Nc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C15H21N5O/c1-10-5-3-2-4-6-11(10)19-15(21)20-13-9-17-14-12(18-13)7-8-16-14/h7-11H,2-6H2,1H3,(H,16,17)(H2,18,19,20,21)/t10-,11+/m1/s1 |
| InChIKey | RKTIESXUCQODPY-MNOVXSKESA-N |
| XLogP | 3.05 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |