C14H19N5O — CID 46235785
1-(3-methylcyclohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 46235785) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-(3-methylcyclohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
| Compound Name | 1-(3-methylcyclohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
|---|---|
| PubChem CID | 46235785 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | 1-(3-methylcyclohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | CC1CCCC(NC(=O)Nc2cnc3[nH]ccc3n2)C1 |
| InChI | InChI=1S/C14H19N5O/c1-9-3-2-4-10(7-9)17-14(20)19-12-8-16-13-11(18-12)5-6-15-13/h5-6,8-10H,2-4,7H2,1H3,(H,15,16)(H2,17,18,19,20) |
| InChIKey | UDLRVVWAFYHEBQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |