About 5H-pyrrolo[2,3-b]pyrazin-2-ylurea
5H-pyrrolo[2,3-b]pyrazin-2-ylurea (PubChem CID 67385138) has the molecular formula C7H7N5O
and a molecular weight of 177.17 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyrazin-2-ylurea.
Molecular Properties
| Compound Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylurea |
| PubChem CID | 67385138 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylurea |
| SMILES | NC(=O)Nc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C7H7N5O/c8-7(13)12-5-3-10-6-4(11-5)1-2-9-6/h1-3H,(H,9,10)(H3,8,11,12,13) |
| InChIKey | HAOZWDPOGIFHSV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5H-pyrrolo[2,3-b]pyrazin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-pyrrolo[2,3-b]pyrazin-2-ylurea?
The IUPAC name of 5H-pyrrolo[2,3-b]pyrazin-2-ylurea (CID 67385138) is 5H-pyrrolo[2,3-b]pyrazin-2-ylurea.
What is the SMILES notation for 5H-pyrrolo[2,3-b]pyrazin-2-ylurea?
The canonical SMILES for 5H-pyrrolo[2,3-b]pyrazin-2-ylurea is NC(=O)Nc1cnc2[nH]ccc2n1.
What is the InChIKey of 5H-pyrrolo[2,3-b]pyrazin-2-ylurea?
The InChIKey is HAOZWDPOGIFHSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N5O/c8-7(13)12-5-3-10-6-4(11-5)1-2-9-6/h1-3H,(H,9,10)(H3,8,11,12,13).
What are the key properties of 5H-pyrrolo[2,3-b]pyrazin-2-ylurea?
5H-pyrrolo[2,3-b]pyrazin-2-ylurea has a molecular weight of 177.17 g/mol, XLogP of 0.45, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-pyrrolo[2,3-b]pyrazin-2-ylurea is sourced from PubChem (CID 67385138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).