C7H7N5O — CID 67385138
5H-pyrrolo[2,3-b]pyrazin-2-ylurea (PubChem CID 67385138) has the molecular formula C7H7N5O and a molecular weight of 177.17 g/mol. Its IUPAC name is 5H-pyrrolo[2,3-b]pyrazin-2-ylurea.
| Compound Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylurea |
|---|---|
| PubChem CID | 67385138 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | 5H-pyrrolo[2,3-b]pyrazin-2-ylurea |
| SMILES | NC(=O)Nc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C7H7N5O/c8-7(13)12-5-3-10-6-4(11-5)1-2-9-6/h1-3H,(H,9,10)(H3,8,11,12,13) |
| InChIKey | HAOZWDPOGIFHSV-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |