C18H34O5 — CID 46242671
(E)-2-(3,3-diethoxypropyl)-7,7-diethoxyhept-2-enal (PubChem CID 46242671) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E)-2-(3,3-diethoxypropyl)-7,7-diethoxyhept-2-enal.
| Compound Name | (E)-2-(3,3-diethoxypropyl)-7,7-diethoxyhept-2-enal |
|---|---|
| PubChem CID | 46242671 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (E)-2-(3,3-diethoxypropyl)-7,7-diethoxyhept-2-enal |
| SMILES | CCOC(CCC/C=C(/C=O)CCC(OCC)OCC)OCC |
| InChI | InChI=1S/C18H34O5/c1-5-20-17(21-6-2)12-10-9-11-16(15-19)13-14-18(22-7-3)23-8-4/h11,15,17-18H,5-10,12-14H2,1-4H3/b16-11+ |
| InChIKey | RZVMCGARGCJPRQ-LFIBNONCSA-N |
| XLogP | 3.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|