C20H40O3 — CID 87072822
butane;1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal (PubChem CID 87072822) has the molecular formula C20H40O3 and a molecular weight of 328.54 g/mol. Its IUPAC name is butane;1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal.
| Compound Name | butane;1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 87072822 |
| Molecular Formula | C20H40O3 |
| Molecular Weight | 328.54 g/mol |
| Exact Mass | 328.30 |
| IUPAC Name | butane;1,1-diethoxyethane;3,7-dimethylocta-2,6-dienal |
| SMILES | CC(C)=CCCC(C)=CC=O.CCCC.CCOC(C)OCC |
| InChI | InChI=1S/C10H16O.C6H14O2.C4H10/c1-9(2)5-4-6-10(3)7-8-11;1-4-7-6(3)8-5-2;1-3-4-2/h5,7-8H,4,6H2,1-3H3;6H,4-5H2,1-3H3;3-4H2,1-2H3 |
| InChIKey | MEYVRRAMBMWUDU-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|