C36H46N4O4+2 — CID 46243695
3-[4-[3-[1-(3-aminopropyl)pyridin-1-ium-4-yl]-2,4-bis(3,4-dimethoxyphenyl)cyclobutyl]pyridin-1-ium-1-yl]propan-1-amine (PubChem CID 46243695) has the molecular formula C36H46N4O4+2 and a molecular weight of 598.79 g/mol. Its IUPAC name is 3-[4-[3-[1-(3-aminopropyl)pyridin-1-ium-4-yl]-2,4-bis(3,4-dimethoxyphenyl)cyclobutyl]pyridin-1-ium-1-yl]propan-1-amine.
| Compound Name | 3-[4-[3-[1-(3-aminopropyl)pyridin-1-ium-4-yl]-2,4-bis(3,4-dimethoxyphenyl)cyclobutyl]pyridin-1-ium-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 46243695 |
| Molecular Formula | C36H46N4O4+2 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.35 |
| IUPAC Name | 3-[4-[3-[1-(3-aminopropyl)pyridin-1-ium-4-yl]-2,4-bis(3,4-dimethoxyphenyl)cyclobutyl]pyridin-1-ium-1-yl]propan-1-amine |
| SMILES | COc1ccc(C2C(c3cc[n+](CCCN)cc3)C(c3ccc(OC)c(OC)c3)C2c2cc[n+](CCCN)cc2)cc1OC |
| InChI | InChI=1S/C36H46N4O4/c1-41-29-9-7-27(23-31(29)43-3)35-33(25-11-19-39(20-12-25)17-5-15-37)36(28-8-10-30(42-2)32(24-28)44-4)34(35)26-13-21-40(22-14-26)18-6-16-38/h7-14,19-24,33-36H,5-6,15-18,37-38H2,1-4H3/q+2 |
| InChIKey | ZZLCRSNJMVZXKV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|