C15H14N2S — CID 46244190
5-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazole (PubChem CID 46244190) has the molecular formula C15H14N2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 5-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazole.
| Compound Name | 5-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 46244190 |
| Molecular Formula | C15H14N2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 5-(2,4,6-trimethylphenyl)-2,1,3-benzothiadiazole |
| SMILES | Cc1cc(C)c(-c2ccc3nsnc3c2)c(C)c1 |
| InChI | InChI=1S/C15H14N2S/c1-9-6-10(2)15(11(3)7-9)12-4-5-13-14(8-12)17-18-16-13/h4-8H,1-3H3 |
| InChIKey | XLMDNQLFWLPYQN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |