C17H18F3N5O4 — CID 46245558
N-(2,5-dimethoxyphenyl)-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 46245558) has the molecular formula C17H18F3N5O4 and a molecular weight of 413.36 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-(2,5-dimethoxyphenyl)-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 46245558 |
| Molecular Formula | C17H18F3N5O4 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | COc1ccc(OC)c(Nc2cc(C)nc3nc(C)nn23)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17N5O2.C2HF3O2/c1-9-7-14(20-15(16-9)17-10(2)19-20)18-12-8-11(21-3)5-6-13(12)22-4;3-2(4,5)1(6)7/h5-8,18H,1-4H3;(H,6,7) |
| InChIKey | KIXFVPSEMKPUHW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 110.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |