C25H23N5O5S2 — CID 46251726
(6Z)-5-imino-6-[[1-[3-(4-methoxyphenoxy)propyl]indol-3-yl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one (PubChem CID 46251726) has the molecular formula C25H23N5O5S2 and a molecular weight of 537.62 g/mol. Its IUPAC name is (6Z)-5-imino-6-[[1-[3-(4-methoxyphenoxy)propyl]indol-3-yl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one.
| Compound Name | (6Z)-5-imino-6-[[1-[3-(4-methoxyphenoxy)propyl]indol-3-yl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 46251726 |
| Molecular Formula | C25H23N5O5S2 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | (6Z)-5-imino-6-[[1-[3-(4-methoxyphenoxy)propyl]indol-3-yl]methylidene]-3-methylsulfonyl-[1,2,4]thiadiazolo[4,5-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cn(CCCOc3ccc(OC)cc3)c3ccccc23)\C(=O)N=C2SN=C(S(C)(=O)=O)N2\1 |
| InChI | InChI=1S/C25H23N5O5S2/c1-34-17-8-10-18(11-9-17)35-13-5-12-29-15-16(19-6-3-4-7-21(19)29)14-20-22(26)30-24(27-23(20)31)36-28-25(30)37(2,32)33/h3-4,6-11,14-15,26H,5,12-13H2,1-2H3/b20-14-,26-22+ |
| InChIKey | MMIFZKHFHJYYAB-SMAGERFBSA-N |
| XLogP | 3.74 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|