C18H30N2O5 — CID 46256603
tert-butyl 4-[(Z)-3-(dimethylamino)-2-ethoxycarbonylprop-2-enoyl]piperidine-1-carboxylate (PubChem CID 46256603) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-3-(dimethylamino)-2-ethoxycarbonylprop-2-enoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-3-(dimethylamino)-2-ethoxycarbonylprop-2-enoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46256603 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | tert-butyl 4-[(Z)-3-(dimethylamino)-2-ethoxycarbonylprop-2-enoyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H30N2O5/c1-7-24-16(22)14(12-19(5)6)15(21)13-8-10-20(11-9-13)17(23)25-18(2,3)4/h12-13H,7-11H2,1-6H3/b14-12- |
| InChIKey | IPKOEZRSHXJNOX-OWBHPGMISA-N |
| XLogP | 2.21 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|