C29H43N3O7 — CID 21192552
diethyl 2-[[N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-4-(morpholin-4-ylmethyl)anilino]methylidene]propanedioate (PubChem CID 21192552) has the molecular formula C29H43N3O7 and a molecular weight of 545.68 g/mol. Its IUPAC name is diethyl 2-[[N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-4-(morpholin-4-ylmethyl)anilino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-4-(morpholin-4-ylmethyl)anilino]methylidene]propanedioate |
|---|---|
| PubChem CID | 21192552 |
| Molecular Formula | C29H43N3O7 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.31 |
| IUPAC Name | diethyl 2-[[N-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-4-(morpholin-4-ylmethyl)anilino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CN(c1ccc(CN2CCOCC2)cc1)C1CCN(C(=O)OC(C)(C)C)CC1)C(=O)OCC |
| InChI | InChI=1S/C29H43N3O7/c1-6-37-26(33)25(27(34)38-7-2)21-32(24-12-14-31(15-13-24)28(35)39-29(3,4)5)23-10-8-22(9-11-23)20-30-16-18-36-19-17-30/h8-11,21,24H,6-7,12-20H2,1-5H3 |
| InChIKey | IJDGQULQJXOWRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|