C24H23ClN3O2+ — CID 46257173
N-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46257173) has the molecular formula C24H23ClN3O2+ and a molecular weight of 420.92 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46257173 |
| Molecular Formula | C24H23ClN3O2+ |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(4-chlorophenyl)-2-(3,4-dimethylphenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | Cc1ccc(N2C(=O)C[n+]3ccccc3C2(C)C(=O)Nc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C24H22ClN3O2/c1-16-7-12-20(14-17(16)2)28-22(29)15-27-13-5-4-6-21(27)24(28,3)23(30)26-19-10-8-18(25)9-11-19/h4-14H,15H2,1-3H3/p+1 |
| InChIKey | NHOQGABQNCUYIL-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|