C24H22ClN4O3+ — CID 46257175
2-(4-acetamidophenyl)-N-(4-chlorophenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide (PubChem CID 46257175) has the molecular formula C24H22ClN4O3+ and a molecular weight of 449.92 g/mol. Its IUPAC name is 2-(4-acetamidophenyl)-N-(4-chlorophenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide.
| Compound Name | 2-(4-acetamidophenyl)-N-(4-chlorophenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
|---|---|
| PubChem CID | 46257175 |
| Molecular Formula | C24H22ClN4O3+ |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-(4-acetamidophenyl)-N-(4-chlorophenyl)-1-methyl-3-oxo-4H-pyrido[1,2-a]pyrazin-5-ium-1-carboxamide |
| SMILES | CC(=O)Nc1ccc(N2C(=O)C[n+]3ccccc3C2(C)C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21ClN4O3/c1-16(30)26-18-10-12-20(13-11-18)29-22(31)15-28-14-4-3-5-21(28)24(29,2)23(32)27-19-8-6-17(25)7-9-19/h3-14H,15H2,1-2H3,(H-,26,27,30,32)/p+1 |
| InChIKey | GNRVWVQKZXFWCP-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|