C24H22N2O2S — CID 46258733
N-(2-benzoylphenyl)-4-ethyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide (PubChem CID 46258733) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is N-(2-benzoylphenyl)-4-ethyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-(2-benzoylphenyl)-4-ethyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46258733 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-(2-benzoylphenyl)-4-ethyl-2,3-dihydro-1,4-benzothiazine-6-carboxamide |
| SMILES | CCN1CCSc2ccc(C(=O)Nc3ccccc3C(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C24H22N2O2S/c1-2-26-14-15-29-22-13-12-18(16-21(22)26)24(28)25-20-11-7-6-10-19(20)23(27)17-8-4-3-5-9-17/h3-13,16H,2,14-15H2,1H3,(H,25,28) |
| InChIKey | QEBVVQAYDWFWQX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |