C22H20N6O4 — CID 46263862
[5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]-(2-nitrophenyl)methanone (PubChem CID 46263862) has the molecular formula C22H20N6O4 and a molecular weight of 432.44 g/mol. Its IUPAC name is [5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]-(2-nitrophenyl)methanone.
| Compound Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 46263862 |
| Molecular Formula | C22H20N6O4 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [5-[[4-(dimethylamino)phenyl]methylamino]-3-(furan-2-yl)-1,2,4-triazol-1-yl]-(2-nitrophenyl)methanone |
| SMILES | CN(C)c1ccc(CNc2nc(-c3ccco3)nn2C(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N6O4/c1-26(2)16-11-9-15(10-12-16)14-23-22-24-20(19-8-5-13-32-19)25-27(22)21(29)17-6-3-4-7-18(17)28(30)31/h3-13H,14H2,1-2H3,(H,23,24,25) |
| InChIKey | SZQPXFCRENUPFG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|