C15H10N6O4S2 — CID 46264578
2-methyl-7-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one (PubChem CID 46264578) has the molecular formula C15H10N6O4S2 and a molecular weight of 402.42 g/mol. Its IUPAC name is 2-methyl-7-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 2-methyl-7-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 46264578 |
| Molecular Formula | C15H10N6O4S2 |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 2-methyl-7-[[5-(4-nitrophenyl)-1,3,4-oxadiazol-2-yl]sulfanylmethyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-5-one |
| SMILES | Cc1nn2c(=O)cc(CSc3nnc(-c4ccc([N+](=O)[O-])cc4)o3)nc2s1 |
| InChI | InChI=1S/C15H10N6O4S2/c1-8-19-20-12(22)6-10(16-14(20)27-8)7-26-15-18-17-13(25-15)9-2-4-11(5-3-9)21(23)24/h2-6H,7H2,1H3 |
| InChIKey | SPYMLPSEMMHGML-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 129.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|