C27H33N3O3 — CID 46273257
3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 46273257) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is 3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | 3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 46273257 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 3-methyl-2-[(2-methylphenyl)methyl]-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | Cc1ccccc1CN1C(=O)c2cc3ccccc3n2CC1(C)C(=O)NCCCOC(C)C |
| InChI | InChI=1S/C27H33N3O3/c1-19(2)33-15-9-14-28-26(32)27(4)18-29-23-13-8-7-11-21(23)16-24(29)25(31)30(27)17-22-12-6-5-10-20(22)3/h5-8,10-13,16,19H,9,14-15,17-18H2,1-4H3,(H,28,32) |
| InChIKey | TUIVTLOCWFOQSG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|