C28H35N3O3 — CID 92740238
(3R)-2-[(4-ethylphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92740238) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is (3R)-2-[(4-ethylphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3R)-2-[(4-ethylphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92740238 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | (3R)-2-[(4-ethylphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | CCc1ccc(CN2C(=O)c3cc4ccccc4n3C[C@]2(C)C(=O)NCCCOC(C)C)cc1 |
| InChI | InChI=1S/C28H35N3O3/c1-5-21-11-13-22(14-12-21)18-31-26(32)25-17-23-9-6-7-10-24(23)30(25)19-28(31,4)27(33)29-15-8-16-34-20(2)3/h6-7,9-14,17,20H,5,8,15-16,18-19H2,1-4H3,(H,29,33)/t28-/m1/s1 |
| InChIKey | CWYFHNJXUVMNOG-MUUNZHRXSA-N |
| XLogP | 4.55 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|