C28H35N3O5 — CID 92740224
(3R)-2-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92740224) has the molecular formula C28H35N3O5 and a molecular weight of 493.60 g/mol. Its IUPAC name is (3R)-2-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3R)-2-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92740224 |
| Molecular Formula | C28H35N3O5 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (3R)-2-[(2,4-dimethoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COc1ccc(CN2C(=O)c3cc4ccccc4n3C[C@]2(C)C(=O)NCCCOC(C)C)c(OC)c1 |
| InChI | InChI=1S/C28H35N3O5/c1-19(2)36-14-8-13-29-27(33)28(3)18-30-23-10-7-6-9-20(23)15-24(30)26(32)31(28)17-21-11-12-22(34-4)16-25(21)35-5/h6-7,9-12,15-16,19H,8,13-14,17-18H2,1-5H3,(H,29,33)/t28-/m1/s1 |
| InChIKey | MPHYVBXXFXQIKO-MUUNZHRXSA-N |
| XLogP | 4.00 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|