C27H33N3O4 — CID 92740215
(3S)-2-[(3-methoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 92740215) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (3S)-2-[(3-methoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | (3S)-2-[(3-methoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 92740215 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (3S)-2-[(3-methoxyphenyl)methyl]-3-methyl-1-oxo-N-(3-propan-2-yloxypropyl)-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COc1cccc(CN2C(=O)c3cc4ccccc4n3C[C@@]2(C)C(=O)NCCCOC(C)C)c1 |
| InChI | InChI=1S/C27H33N3O4/c1-19(2)34-14-8-13-28-26(32)27(3)18-29-23-12-6-5-10-21(23)16-24(29)25(31)30(27)17-20-9-7-11-22(15-20)33-4/h5-7,9-12,15-16,19H,8,13-14,17-18H2,1-4H3,(H,28,32)/t27-/m0/s1 |
| InChIKey | ILBVHHKLETUYPT-MHZLTWQESA-N |
| XLogP | 4.00 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|