C28H27F3N4O — CID 46276168
4-(diethylamino)-N-[4-methyl-2-[3-(trifluoromethyl)anilino]quinolin-6-yl]benzamide (PubChem CID 46276168) has the molecular formula C28H27F3N4O and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-(diethylamino)-N-[4-methyl-2-[3-(trifluoromethyl)anilino]quinolin-6-yl]benzamide.
| Compound Name | 4-(diethylamino)-N-[4-methyl-2-[3-(trifluoromethyl)anilino]quinolin-6-yl]benzamide |
|---|---|
| PubChem CID | 46276168 |
| Molecular Formula | C28H27F3N4O |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | 4-(diethylamino)-N-[4-methyl-2-[3-(trifluoromethyl)anilino]quinolin-6-yl]benzamide |
| SMILES | CCN(CC)c1ccc(C(=O)Nc2ccc3nc(Nc4cccc(C(F)(F)F)c4)cc(C)c3c2)cc1 |
| InChI | InChI=1S/C28H27F3N4O/c1-4-35(5-2)23-12-9-19(10-13-23)27(36)33-22-11-14-25-24(17-22)18(3)15-26(34-25)32-21-8-6-7-20(16-21)28(29,30)31/h6-17H,4-5H2,1-3H3,(H,32,34)(H,33,36) |
| InChIKey | NSXUEZGMVOVIBH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |