C22H17N5O2 — CID 4628999
8-ethyl-6-imino-1-phenyl-3-pyridin-4-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 4628999) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 8-ethyl-6-imino-1-phenyl-3-pyridin-4-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 8-ethyl-6-imino-1-phenyl-3-pyridin-4-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 4628999 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 8-ethyl-6-imino-1-phenyl-3-pyridin-4-yl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(c3ccccc3)OC(c3ccncc3)C(C#N)(C#N)C1(C#N)C2CC |
| InChI | InChI=1S/C22H17N5O2/c1-2-17-21(14-25)19(26)29-22(17,16-6-4-3-5-7-16)28-18(20(21,12-23)13-24)15-8-10-27-11-9-15/h3-11,17-18,26H,2H2,1H3/b26-19- |
| InChIKey | IISMTQFLLAZQIG-XHPQRKPJSA-N |
| XLogP | 3.58 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|