C25H20N4O4 — CID 4629144
methyl 4-(4,4,5-tricyano-8-ethyl-6-imino-1-phenyl-2,7-dioxabicyclo[3.2.1]octan-3-yl)benzoate (PubChem CID 4629144) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is methyl 4-(4,4,5-tricyano-8-ethyl-6-imino-1-phenyl-2,7-dioxabicyclo[3.2.1]octan-3-yl)benzoate.
| Compound Name | methyl 4-(4,4,5-tricyano-8-ethyl-6-imino-1-phenyl-2,7-dioxabicyclo[3.2.1]octan-3-yl)benzoate |
|---|---|
| PubChem CID | 4629144 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | methyl 4-(4,4,5-tricyano-8-ethyl-6-imino-1-phenyl-2,7-dioxabicyclo[3.2.1]octan-3-yl)benzoate |
| SMILES | [H]/N=C1\OC2(c3ccccc3)OC(c3ccc(C(=O)OC)cc3)C(C#N)(C#N)C1(C#N)C2CC |
| InChI | InChI=1S/C25H20N4O4/c1-3-19-24(15-28)22(29)33-25(19,18-7-5-4-6-8-18)32-20(23(24,13-26)14-27)16-9-11-17(12-10-16)21(30)31-2/h4-12,19-20,29H,3H2,1-2H3/b29-22- |
| InChIKey | WHDBCGOGOROXML-IADYIPOJSA-N |
| XLogP | 3.97 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|