C27H24N2O5S2 — CID 46301750
methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-quinolin-2-ylsulfanylbutanoylamino)thiophene-3-carboxylate (PubChem CID 46301750) has the molecular formula C27H24N2O5S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-quinolin-2-ylsulfanylbutanoylamino)thiophene-3-carboxylate.
| Compound Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-quinolin-2-ylsulfanylbutanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46301750 |
| Molecular Formula | C27H24N2O5S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | methyl 4-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(2-quinolin-2-ylsulfanylbutanoylamino)thiophene-3-carboxylate |
| SMILES | CCC(Sc1ccc2ccccc2n1)C(=O)Nc1scc(-c2ccc3c(c2)OCCO3)c1C(=O)OC |
| InChI | InChI=1S/C27H24N2O5S2/c1-3-22(36-23-11-9-16-6-4-5-7-19(16)28-23)25(30)29-26-24(27(31)32-2)18(15-35-26)17-8-10-20-21(14-17)34-13-12-33-20/h4-11,14-15,22H,3,12-13H2,1-2H3,(H,29,30) |
| InChIKey | JLWWEPJTQRVGQX-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|