C16H19ClN2O6S2 — CID 46307002
4-chloro-3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide (PubChem CID 46307002) has the molecular formula C16H19ClN2O6S2 and a molecular weight of 434.92 g/mol. Its IUPAC name is 4-chloro-3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide.
| Compound Name | 4-chloro-3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
|---|---|
| PubChem CID | 46307002 |
| Molecular Formula | C16H19ClN2O6S2 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | 4-chloro-3-(4,4-dimethyl-1,1,3-trioxo-1,2-thiazolidin-2-yl)-N-(1,1-dioxothiolan-3-yl)benzamide |
| SMILES | CC1(C)CS(=O)(=O)N(c2cc(C(=O)NC3CCS(=O)(=O)C3)ccc2Cl)C1=O |
| InChI | InChI=1S/C16H19ClN2O6S2/c1-16(2)9-27(24,25)19(15(16)21)13-7-10(3-4-12(13)17)14(20)18-11-5-6-26(22,23)8-11/h3-4,7,11H,5-6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | VGUNTLFOSBFOAH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |