C26H27ClN6O — CID 46328159
[4-(4-chlorophenyl)piperazin-1-yl]-[1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidin-3-yl]methanone (PubChem CID 46328159) has the molecular formula C26H27ClN6O and a molecular weight of 475.00 g/mol. Its IUPAC name is [4-(4-chlorophenyl)piperazin-1-yl]-[1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidin-3-yl]methanone.
| Compound Name | [4-(4-chlorophenyl)piperazin-1-yl]-[1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 46328159 |
| Molecular Formula | C26H27ClN6O |
| Molecular Weight | 475.00 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | [4-(4-chlorophenyl)piperazin-1-yl]-[1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(c2nc3ncccc3n3cccc23)C1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C26H27ClN6O/c27-20-7-9-21(10-8-20)30-14-16-31(17-15-30)26(34)19-4-2-12-32(18-19)25-23-6-3-13-33(23)22-5-1-11-28-24(22)29-25/h1,3,5-11,13,19H,2,4,12,14-18H2 |
| InChIKey | KBARGUFGUIMIOH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 56.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |