C30H36N6O — CID 92870585
(3S)-N-[2-(4-benzylpiperidin-1-yl)ethyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide (PubChem CID 92870585) has the molecular formula C30H36N6O and a molecular weight of 496.66 g/mol. Its IUPAC name is (3S)-N-[2-(4-benzylpiperidin-1-yl)ethyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(4-benzylpiperidin-1-yl)ethyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92870585 |
| Molecular Formula | C30H36N6O |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.30 |
| IUPAC Name | (3S)-N-[2-(4-benzylpiperidin-1-yl)ethyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCCN1CCC(Cc2ccccc2)CC1)[C@H]1CCCN(c2nc3ncccc3n3cccc23)C1 |
| InChI | InChI=1S/C30H36N6O/c37-30(32-15-20-34-18-12-24(13-19-34)21-23-7-2-1-3-8-23)25-9-5-16-35(22-25)29-27-11-6-17-36(27)26-10-4-14-31-28(26)33-29/h1-4,6-8,10-11,14,17,24-25H,5,9,12-13,15-16,18-22H2,(H,32,37)/t25-/m0/s1 |
| InChIKey | MLLPUZDRIBRYDN-VWLOTQADSA-N |
| XLogP | 4.17 |
| TPSA | 65.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |