C25H35N7O — CID 46328213
N-[3-(4-ethylpiperazin-1-yl)propyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide (PubChem CID 46328213) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)propyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46328213 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)propyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)C2CCCN(c3nc4ncccc4n4cccc34)C2)CC1 |
| InChI | InChI=1S/C25H35N7O/c1-2-29-15-17-30(18-16-29)12-6-11-27-25(33)20-7-4-13-31(19-20)24-22-9-5-14-32(22)21-8-3-10-26-23(21)28-24/h3,5,8-10,14,20H,2,4,6-7,11-13,15-19H2,1H3,(H,27,33) |
| InChIKey | FCJHDZLIZWEQKH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|