C25H27N5O2 — CID 46328215
N-[(2-ethoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide (PubChem CID 46328215) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[(2-ethoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide.
| Compound Name | N-[(2-ethoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46328215 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-[(2-ethoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
| SMILES | CCOc1ccccc1CNC(=O)C1CCCN(c2nc3ncccc3n3cccc23)C1 |
| InChI | InChI=1S/C25H27N5O2/c1-2-32-22-12-4-3-8-18(22)16-27-25(31)19-9-6-14-29(17-19)24-21-11-7-15-30(21)20-10-5-13-26-23(20)28-24/h3-5,7-8,10-13,15,19H,2,6,9,14,16-17H2,1H3,(H,27,31) |
| InChIKey | ADEWKNYVWYNFIG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |