C24H25N5O2 — CID 92870533
(3S)-N-[(3-methoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide (PubChem CID 92870533) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is (3S)-N-[(3-methoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(3-methoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92870533 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (3S)-N-[(3-methoxyphenyl)methyl]-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
| SMILES | COc1cccc(CNC(=O)[C@H]2CCCN(c3nc4ncccc4n4cccc34)C2)c1 |
| InChI | InChI=1S/C24H25N5O2/c1-31-19-8-2-6-17(14-19)15-26-24(30)18-7-4-12-28(16-18)23-21-10-5-13-29(21)20-9-3-11-25-22(20)27-23/h2-3,5-6,8-11,13-14,18H,4,7,12,15-16H2,1H3,(H,26,30)/t18-/m0/s1 |
| InChIKey | SQZNXSOZXHDVAL-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |