C24H25N5O — CID 92870513
(3S)-N-(3,4-dimethylphenyl)-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide (PubChem CID 92870513) has the molecular formula C24H25N5O and a molecular weight of 399.50 g/mol. Its IUPAC name is (3S)-N-(3,4-dimethylphenyl)-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(3,4-dimethylphenyl)-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92870513 |
| Molecular Formula | C24H25N5O |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | (3S)-N-(3,4-dimethylphenyl)-1-(2,8,10-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@H]2CCCN(c3nc4ncccc4n4cccc34)C2)cc1C |
| InChI | InChI=1S/C24H25N5O/c1-16-9-10-19(14-17(16)2)26-24(30)18-6-4-12-28(15-18)23-21-8-5-13-29(21)20-7-3-11-25-22(20)27-23/h3,5,7-11,13-14,18H,4,6,12,15H2,1-2H3,(H,26,30)/t18-/m0/s1 |
| InChIKey | FHNAIWOUNCFVDG-SFHVURJKSA-N |
| XLogP | 4.35 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |