C30H38N4O — CID 46334639
2-methyl-8-phenyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]quinoline-4-carboxamide (PubChem CID 46334639) has the molecular formula C30H38N4O and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-methyl-8-phenyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]quinoline-4-carboxamide.
| Compound Name | 2-methyl-8-phenyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 46334639 |
| Molecular Formula | C30H38N4O |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | 2-methyl-8-phenyl-N-[3-(4-piperidin-1-ylpiperidin-1-yl)propyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)NCCCN2CCC(N3CCCCC3)CC2)c2cccc(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C30H38N4O/c1-23-22-28(27-13-8-12-26(29(27)32-23)24-10-4-2-5-11-24)30(35)31-16-9-17-33-20-14-25(15-21-33)34-18-6-3-7-19-34/h2,4-5,8,10-13,22,25H,3,6-7,9,14-21H2,1H3,(H,31,35) |
| InChIKey | UXYHFZPLWAZIGC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|