C20H26N4O4 — CID 46340940
N-[2-(3-methoxypropylamino)-2-oxoethyl]-2,3-dimethyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide (PubChem CID 46340940) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is N-[2-(3-methoxypropylamino)-2-oxoethyl]-2,3-dimethyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide.
| Compound Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-2,3-dimethyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
|---|---|
| PubChem CID | 46340940 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[2-(3-methoxypropylamino)-2-oxoethyl]-2,3-dimethyl-1-oxo-4H-pyrazino[1,2-a]indole-3-carboxamide |
| SMILES | COCCCNC(=O)CNC(=O)C1(C)Cn2c(cc3ccccc32)C(=O)N1C |
| InChI | InChI=1S/C20H26N4O4/c1-20(19(27)22-12-17(25)21-9-6-10-28-3)13-24-15-8-5-4-7-14(15)11-16(24)18(26)23(20)2/h4-5,7-8,11H,6,9-10,12-13H2,1-3H3,(H,21,25)(H,22,27) |
| InChIKey | RSVOXBCYZHQLGT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|