C16H11F4N3O2S — CID 46341187
2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)butanamide (PubChem CID 46341187) has the molecular formula C16H11F4N3O2S and a molecular weight of 385.34 g/mol. Its IUPAC name is 2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)butanamide.
| Compound Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)butanamide |
|---|---|
| PubChem CID | 46341187 |
| Molecular Formula | C16H11F4N3O2S |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 2-([1,3]oxazolo[4,5-b]pyridin-2-ylsulfanyl)-N-(2,3,5,6-tetrafluorophenyl)butanamide |
| SMILES | CCC(Sc1nc2ncccc2o1)C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C16H11F4N3O2S/c1-2-10(26-16-23-14-9(25-16)4-3-5-21-14)15(24)22-13-11(19)7(17)6-8(18)12(13)20/h3-6,10H,2H2,1H3,(H,22,24) |
| InChIKey | XJJFAGXAGYXOAN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|