C21H21N3O8 — CID 46352312
[4-[3-acetyl-2-[(4-methyl-2-nitrophenoxy)methyl]-2H-1,3,4-oxadiazol-5-yl]-2-methoxyphenyl] acetate (PubChem CID 46352312) has the molecular formula C21H21N3O8 and a molecular weight of 443.41 g/mol. Its IUPAC name is [4-[3-acetyl-2-[(4-methyl-2-nitrophenoxy)methyl]-2H-1,3,4-oxadiazol-5-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[3-acetyl-2-[(4-methyl-2-nitrophenoxy)methyl]-2H-1,3,4-oxadiazol-5-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 46352312 |
| Molecular Formula | C21H21N3O8 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [4-[3-acetyl-2-[(4-methyl-2-nitrophenoxy)methyl]-2H-1,3,4-oxadiazol-5-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C2=NN(C(C)=O)C(COc3ccc(C)cc3[N+](=O)[O-])O2)ccc1OC(C)=O |
| InChI | InChI=1S/C21H21N3O8/c1-12-5-7-17(16(9-12)24(27)28)30-11-20-23(13(2)25)22-21(32-20)15-6-8-18(31-14(3)26)19(10-15)29-4/h5-10,20H,11H2,1-4H3 |
| InChIKey | SLCZVDAPPLIXLB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 129.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|