C24H16N2O6 — CID 4638333
[1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-oxo-1H-quinoline-4-carboxylate (PubChem CID 4638333) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is [1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-oxo-1H-quinoline-4-carboxylate.
| Compound Name | [1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-oxo-1H-quinoline-4-carboxylate |
|---|---|
| PubChem CID | 4638333 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [1-(4-nitrophenyl)-2-oxo-2-phenylethyl] 2-oxo-1H-quinoline-4-carboxylate |
| SMILES | O=C(OC(C(=O)c1ccccc1)c1ccc([N+](=O)[O-])cc1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C24H16N2O6/c27-21-14-19(18-8-4-5-9-20(18)25-21)24(29)32-23(22(28)15-6-2-1-3-7-15)16-10-12-17(13-11-16)26(30)31/h1-14,23H,(H,25,27) |
| InChIKey | XGMOWJCKYIMRCP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|