C25H29N5OS — CID 46384020
6-ethyl-1-phenyl-N-(3-pyrrolidin-1-ylpropyl)-3-thiophen-2-ylpyrrolo[3,2-d]pyrazole-5-carboxamide (PubChem CID 46384020) has the molecular formula C25H29N5OS and a molecular weight of 447.61 g/mol. Its IUPAC name is 6-ethyl-1-phenyl-N-(3-pyrrolidin-1-ylpropyl)-3-thiophen-2-ylpyrrolo[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 6-ethyl-1-phenyl-N-(3-pyrrolidin-1-ylpropyl)-3-thiophen-2-ylpyrrolo[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 46384020 |
| Molecular Formula | C25H29N5OS |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | 6-ethyl-1-phenyl-N-(3-pyrrolidin-1-ylpropyl)-3-thiophen-2-ylpyrrolo[3,2-d]pyrazole-5-carboxamide |
| SMILES | CCn1c(C(=O)NCCCN2CCCC2)cc2c(-c3cccs3)nn(-c3ccccc3)c21 |
| InChI | InChI=1S/C25H29N5OS/c1-2-29-21(24(31)26-13-9-16-28-14-6-7-15-28)18-20-23(22-12-8-17-32-22)27-30(25(20)29)19-10-4-3-5-11-19/h3-5,8,10-12,17-18H,2,6-7,9,13-16H2,1H3,(H,26,31) |
| InChIKey | XXFHODZZIBVTRA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|