C20H17N5O3S2 — CID 46390491
2-(4-methoxyphenyl)-N-[5-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 46390491) has the molecular formula C20H17N5O3S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[5-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[5-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 46390491 |
| Molecular Formula | C20H17N5O3S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[5-[(3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nnc(SCc3nc4ccccc4[nH]c3=O)s2)cc1 |
| InChI | InChI=1S/C20H17N5O3S2/c1-28-13-8-6-12(7-9-13)10-17(26)23-19-24-25-20(30-19)29-11-16-18(27)22-15-5-3-2-4-14(15)21-16/h2-9H,10-11H2,1H3,(H,22,27)(H,23,24,26) |
| InChIKey | UUXSZLHUBZQDFP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|