C17H19N5O2S2 — CID 46390517
N-[5-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide (PubChem CID 46390517) has the molecular formula C17H19N5O2S2 and a molecular weight of 389.51 g/mol. Its IUPAC name is N-[5-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide.
| Compound Name | N-[5-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 46390517 |
| Molecular Formula | C17H19N5O2S2 |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[5-[(6,7-dimethyl-3-oxo-4H-quinoxalin-2-yl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nnc(SCc2nc3cc(C)c(C)cc3[nH]c2=O)s1 |
| InChI | InChI=1S/C17H19N5O2S2/c1-4-5-14(23)20-16-21-22-17(26-16)25-8-13-15(24)19-12-7-10(3)9(2)6-11(12)18-13/h6-7H,4-5,8H2,1-3H3,(H,19,24)(H,20,21,23) |
| InChIKey | MPOHXPRRYBFFMV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|