C19H14FN5O2S2 — CID 46390556
3-fluoro-N-[5-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 46390556) has the molecular formula C19H14FN5O2S2 and a molecular weight of 427.49 g/mol. Its IUPAC name is 3-fluoro-N-[5-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 3-fluoro-N-[5-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 46390556 |
| Molecular Formula | C19H14FN5O2S2 |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 3-fluoro-N-[5-[[5-(2-methylphenyl)-1,3,4-oxadiazol-2-yl]methylsulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | Cc1ccccc1-c1nnc(CSc2nnc(NC(=O)c3cccc(F)c3)s2)o1 |
| InChI | InChI=1S/C19H14FN5O2S2/c1-11-5-2-3-8-14(11)17-23-22-15(27-17)10-28-19-25-24-18(29-19)21-16(26)12-6-4-7-13(20)9-12/h2-9H,10H2,1H3,(H,21,24,26) |
| InChIKey | VEILKSAILOVRDW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|