C22H22N2O4S — CID 46394757
8-(4-benzylpiperidin-1-yl)sulfonyl-4H-chromeno[3,4-d][1,2]oxazole (PubChem CID 46394757) has the molecular formula C22H22N2O4S and a molecular weight of 410.50 g/mol. Its IUPAC name is 8-(4-benzylpiperidin-1-yl)sulfonyl-4H-chromeno[3,4-d][1,2]oxazole.
| Compound Name | 8-(4-benzylpiperidin-1-yl)sulfonyl-4H-chromeno[3,4-d][1,2]oxazole |
|---|---|
| PubChem CID | 46394757 |
| Molecular Formula | C22H22N2O4S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 8-(4-benzylpiperidin-1-yl)sulfonyl-4H-chromeno[3,4-d][1,2]oxazole |
| SMILES | O=S(=O)(c1ccc2c(c1)-c1oncc1CO2)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O4S/c25-29(26,24-10-8-17(9-11-24)12-16-4-2-1-3-5-16)19-6-7-21-20(13-19)22-18(15-27-21)14-23-28-22/h1-7,13-14,17H,8-12,15H2 |
| InChIKey | QHVHAOPOKDHZRW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |