C11H15N3O4S — CID 46398262
diethyl 2-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]propanedioate (PubChem CID 46398262) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is diethyl 2-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]propanedioate.
| Compound Name | diethyl 2-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]propanedioate |
|---|---|
| PubChem CID | 46398262 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | diethyl 2-[(4-methyl-1,3-thiazol-2-yl)hydrazinylidene]propanedioate |
| SMILES | CCOC(=O)C(=NNc1nc(C)cs1)C(=O)OCC |
| InChI | InChI=1S/C11H15N3O4S/c1-4-17-9(15)8(10(16)18-5-2)13-14-11-12-7(3)6-19-11/h6H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | DHBZXVWPLXERGN-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|