C24H33ClO2 — CID 4641115
[17-(2-chloroethynyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 4641115) has the molecular formula C24H33ClO2 and a molecular weight of 388.98 g/mol. Its IUPAC name is [17-(2-chloroethynyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [17-(2-chloroethynyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 4641115 |
| Molecular Formula | C24H33ClO2 |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [17-(2-chloroethynyl)-5,10,17-trimethyl-1,2,3,4,6,7,8,9,11,12,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C3CCC4=C(CCC4(C)C#CCl)C3CCC2(C)C1 |
| InChI | InChI=1S/C24H33ClO2/c1-16(26)27-17-7-12-24(4)21-6-5-20-18(8-10-22(20,2)13-14-25)19(21)9-11-23(24,3)15-17/h17,19,21H,5-12,15H2,1-4H3 |
| InChIKey | FNGHATOLMPZLFG-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|