C26H38O6 — CID 124897295
[(3R,5S,8S,9R,10R,11S,13S,14R)-11,17-diacetyloxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 124897295) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [(3R,5S,8S,9R,10R,11S,13S,14R)-11,17-diacetyloxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3R,5S,8S,9R,10R,11S,13S,14R)-11,17-diacetyloxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 124897295 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [(3R,5S,8S,9R,10R,11S,13S,14R)-11,17-diacetyloxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1=CC[C@@H]2[C@@H]3CC[C@@]4(C)C[C@H](OC(C)=O)CC[C@]4(C)[C@@H]3[C@@H](OC(C)=O)C[C@]12C |
| InChI | InChI=1S/C26H38O6/c1-15(27)30-18-9-12-26(6)23-19(10-11-24(26,4)13-18)20-7-8-22(32-17(3)29)25(20,5)14-21(23)31-16(2)28/h8,18-21,23H,7,9-14H2,1-6H3/t18-,19+,20-,21+,23+,24+,25+,26-/m1/s1 |
| InChIKey | NWOUTDZVRWQQMQ-PVLNOBGISA-N |
| XLogP | 4.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|