C21H19BrFN3O3S — CID 46429583
N'-[2-(3-bromophenoxy)propanoyl]-2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide (PubChem CID 46429583) has the molecular formula C21H19BrFN3O3S and a molecular weight of 492.37 g/mol. Its IUPAC name is N'-[2-(3-bromophenoxy)propanoyl]-2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[2-(3-bromophenoxy)propanoyl]-2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 46429583 |
| Molecular Formula | C21H19BrFN3O3S |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N'-[2-(3-bromophenoxy)propanoyl]-2-[(4-fluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(Cc2ccc(F)cc2)sc1C(=O)NNC(=O)C(C)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C21H19BrFN3O3S/c1-12-19(30-18(24-12)10-14-6-8-16(23)9-7-14)21(28)26-25-20(27)13(2)29-17-5-3-4-15(22)11-17/h3-9,11,13H,10H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | QCBATXDGLKONCT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|