C25H23N3O3S — CID 55650629
2-benzyl-4-methyl-N'-(2-naphthalen-2-yloxypropanoyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 55650629) has the molecular formula C25H23N3O3S and a molecular weight of 445.54 g/mol. Its IUPAC name is 2-benzyl-4-methyl-N'-(2-naphthalen-2-yloxypropanoyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-benzyl-4-methyl-N'-(2-naphthalen-2-yloxypropanoyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 55650629 |
| Molecular Formula | C25H23N3O3S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2-benzyl-4-methyl-N'-(2-naphthalen-2-yloxypropanoyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1nc(Cc2ccccc2)sc1C(=O)NNC(=O)C(C)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H23N3O3S/c1-16-23(32-22(26-16)14-18-8-4-3-5-9-18)25(30)28-27-24(29)17(2)31-21-13-12-19-10-6-7-11-20(19)15-21/h3-13,15,17H,14H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | LRPLSFFCLPAWLS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|