C16H15F3N2O3 — CID 46450491
N-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethyl]furan-3-carboxamide (PubChem CID 46450491) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethyl]furan-3-carboxamide.
| Compound Name | N-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 46450491 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-oxo-2-[2-[4-(trifluoromethyl)phenyl]ethylamino]ethyl]furan-3-carboxamide |
| SMILES | O=C(CNC(=O)c1ccoc1)NCCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3N2O3/c17-16(18,19)13-3-1-11(2-4-13)5-7-20-14(22)9-21-15(23)12-6-8-24-10-12/h1-4,6,8,10H,5,7,9H2,(H,20,22)(H,21,23) |
| InChIKey | KYAGATPNDRQDOW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |